C25H17FN6O3 — CID 170305254
2-(4-fluorophenyl)-3-oxo-3-[[4-(3-pyrimidin-2-yl-1H-pyrrolo[3,2-b]pyridin-2-yl)-2-pyridinyl]amino]propanoic acid (PubChem CID 170305254) has the molecular formula C25H17FN6O3 and a molecular weight of 468.45 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3-oxo-3-[[4-(3-pyrimidin-2-yl-1H-pyrrolo[3,2-b]pyridin-2-yl)-2-pyridinyl]amino]propanoic acid.
| Compound Name | 2-(4-fluorophenyl)-3-oxo-3-[[4-(3-pyrimidin-2-yl-1H-pyrrolo[3,2-b]pyridin-2-yl)-2-pyridinyl]amino]propanoic acid |
|---|---|
| PubChem CID | 170305254 |
| Molecular Formula | C25H17FN6O3 |
| Molecular Weight | 468.45 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 2-(4-fluorophenyl)-3-oxo-3-[[4-(3-pyrimidin-2-yl-1H-pyrrolo[3,2-b]pyridin-2-yl)-2-pyridinyl]amino]propanoic acid |
| SMILES | O=C(O)C(C(=O)Nc1cc(-c2[nH]c3cccnc3c2-c2ncccn2)ccn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H17FN6O3/c26-16-6-4-14(5-7-16)19(25(34)35)24(33)32-18-13-15(8-12-27-18)21-20(23-29-10-2-11-30-23)22-17(31-21)3-1-9-28-22/h1-13,19,31H,(H,34,35)(H,27,32,33) |
| InChIKey | HFLIETUDGSQAON-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 133.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|