C18H10F8N2O2 — CID 170305306
1,4-bis(2,2,3,3-tetrafluoropropoxy)naphthalene-2,3-dicarbonitrile (PubChem CID 170305306) has the molecular formula C18H10F8N2O2 and a molecular weight of 438.27 g/mol. Its IUPAC name is 1,4-bis(2,2,3,3-tetrafluoropropoxy)naphthalene-2,3-dicarbonitrile.
| Compound Name | 1,4-bis(2,2,3,3-tetrafluoropropoxy)naphthalene-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 170305306 |
| Molecular Formula | C18H10F8N2O2 |
| Molecular Weight | 438.27 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 1,4-bis(2,2,3,3-tetrafluoropropoxy)naphthalene-2,3-dicarbonitrile |
| SMILES | N#Cc1c(C#N)c(OCC(F)(F)C(F)F)c2ccccc2c1OCC(F)(F)C(F)F |
| InChI | InChI=1S/C18H10F8N2O2/c19-15(20)17(23,24)7-29-13-9-3-1-2-4-10(9)14(12(6-28)11(13)5-27)30-8-18(25,26)16(21)22/h1-4,15-16H,7-8H2 |
| InChIKey | VFAMFFHCPMVNTO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.27 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|