C12H10F9NO4 — CID 170305348
(2R,8S)-2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylic acid (PubChem CID 170305348) has the molecular formula C12H10F9NO4 and a molecular weight of 403.20 g/mol. Its IUPAC name is (2R,8S)-2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylic acid.
| Compound Name | (2R,8S)-2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylic acid |
|---|---|
| PubChem CID | 170305348 |
| Molecular Formula | C12H10F9NO4 |
| Molecular Weight | 403.20 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | (2R,8S)-2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylic acid |
| SMILES | O=C1CC[C@@]2(C(=O)O)C[C@@H](OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)CN12 |
| InChI | InChI=1S/C12H10F9NO4/c13-10(14,15)9(11(16,17)18,12(19,20)21)26-5-3-8(7(24)25)2-1-6(23)22(8)4-5/h5H,1-4H2,(H,24,25)/t5-,8+/m1/s1 |
| InChIKey | HWDPKZHCZSWBSW-XRGYYRRGSA-N |
| XLogP | 2.65 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.20 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |