C14H13F12NO3 — CID 170305387
[(2R,8S)-2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methyl 2,2,2-trifluoroacetate (PubChem CID 170305387) has the molecular formula C14H13F12NO3 and a molecular weight of 471.24 g/mol. Its IUPAC name is [(2R,8S)-2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methyl 2,2,2-trifluoroacetate.
| Compound Name | [(2R,8S)-2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 170305387 |
| Molecular Formula | C14H13F12NO3 |
| Molecular Weight | 471.24 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | [(2R,8S)-2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methyl 2,2,2-trifluoroacetate |
| SMILES | O=C(OC[C@@]12CCCN1C[C@H](OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)C2)C(F)(F)F |
| InChI | InChI=1S/C14H13F12NO3/c15-10(16,17)8(28)29-6-9-2-1-3-27(9)5-7(4-9)30-11(12(18,19)20,13(21,22)23)14(24,25)26/h7H,1-6H2/t7-,9+/m1/s1 |
| InChIKey | GLPHAVOTQPVXHJ-APPZFPTMSA-N |
| XLogP | 4.14 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.24 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |