C11H18N2O2 — CID 170305389
(1S,2S,5R)-2-[(2S)-but-3-en-2-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid (PubChem CID 170305389) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is (1S,2S,5R)-2-[(2S)-but-3-en-2-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid.
| Compound Name | (1S,2S,5R)-2-[(2S)-but-3-en-2-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid |
|---|---|
| PubChem CID | 170305389 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (1S,2S,5R)-2-[(2S)-but-3-en-2-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid |
| SMILES | C=C[C@H](C)[C@@H]1NC[C@H]2CC[C@@H]1N2C(=O)O |
| InChI | InChI=1S/C11H18N2O2/c1-3-7(2)10-9-5-4-8(6-12-10)13(9)11(14)15/h3,7-10,12H,1,4-6H2,2H3,(H,14,15)/t7-,8+,9-,10-/m0/s1 |
| InChIKey | OHARJYZMOIXBSO-JXUBOQSCSA-N |
| XLogP | 1.29 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|