About [1-[[4-methoxy-4-(trifluoromethyl)piperidin-1-yl]methyl]cyclopropyl]methyl 2,2,2-trifluoroacetate
[1-[[4-methoxy-4-(trifluoromethyl)piperidin-1-yl]methyl]cyclopropyl]methyl 2,2,2-trifluoroacetate (PubChem CID 170305441) has the molecular formula C14H19F6NO3
and a molecular weight of 363.30 g/mol. Its IUPAC name is [1-[[4-methoxy-4-(trifluoromethyl)piperidin-1-yl]methyl]cyclopropyl]methyl 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | [1-[[4-methoxy-4-(trifluoromethyl)piperidin-1-yl]methyl]cyclopropyl]methyl 2,2,2-trifluoroacetate |
| PubChem CID | 170305441 |
| Molecular Formula | C14H19F6NO3 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | [1-[[4-methoxy-4-(trifluoromethyl)piperidin-1-yl]methyl]cyclopropyl]methyl 2,2,2-trifluoroacetate |
| SMILES | COC1(C(F)(F)F)CCN(CC2(COC(=O)C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C14H19F6NO3/c1-23-12(14(18,19)20)4-6-21(7-5-12)8-11(2-3-11)9-24-10(22)13(15,16)17/h2-9H2,1H3 |
| InChIKey | XRIFQTDDOQSMOH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[[4-methoxy-4-(trifluoromethyl)piperidin-1-yl]methyl]cyclopropyl]methyl 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[[4-methoxy-4-(trifluoromethyl)piperidin-1-yl]methyl]cyclopropyl]methyl 2,2,2-trifluoroacetate?
The IUPAC name of [1-[[4-methoxy-4-(trifluoromethyl)piperidin-1-yl]methyl]cyclopropyl]methyl 2,2,2-trifluoroacetate (CID 170305441) is [1-[[4-methoxy-4-(trifluoromethyl)piperidin-1-yl]methyl]cyclopropyl]methyl 2,2,2-trifluoroacetate.
What is the SMILES notation for [1-[[4-methoxy-4-(trifluoromethyl)piperidin-1-yl]methyl]cyclopropyl]methyl 2,2,2-trifluoroacetate?
The canonical SMILES for [1-[[4-methoxy-4-(trifluoromethyl)piperidin-1-yl]methyl]cyclopropyl]methyl 2,2,2-trifluoroacetate is COC1(C(F)(F)F)CCN(CC2(COC(=O)C(F)(F)F)CC2)CC1.
What is the InChIKey of [1-[[4-methoxy-4-(trifluoromethyl)piperidin-1-yl]methyl]cyclopropyl]methyl 2,2,2-trifluoroacetate?
The InChIKey is XRIFQTDDOQSMOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F6NO3/c1-23-12(14(18,19)20)4-6-21(7-5-12)8-11(2-3-11)9-24-10(22)13(15,16)17/h2-9H2,1H3.
What are the key properties of [1-[[4-methoxy-4-(trifluoromethyl)piperidin-1-yl]methyl]cyclopropyl]methyl 2,2,2-trifluoroacetate?
[1-[[4-methoxy-4-(trifluoromethyl)piperidin-1-yl]methyl]cyclopropyl]methyl 2,2,2-trifluoroacetate has a molecular weight of 363.30 g/mol, XLogP of 2.92, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[[4-methoxy-4-(trifluoromethyl)piperidin-1-yl]methyl]cyclopropyl]methyl 2,2,2-trifluoroacetate is sourced from PubChem (CID 170305441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).