C33H20ClN3O — CID 170305773
2-chloro-4-(9-phenyldibenzofuran-2-yl)-6-(3-phenylphenyl)-1,3,5-triazine (PubChem CID 170305773) has the molecular formula C33H20ClN3O and a molecular weight of 510.00 g/mol. Its IUPAC name is 2-chloro-4-(9-phenyldibenzofuran-2-yl)-6-(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-chloro-4-(9-phenyldibenzofuran-2-yl)-6-(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 170305773 |
| Molecular Formula | C33H20ClN3O |
| Molecular Weight | 510.00 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | 2-chloro-4-(9-phenyldibenzofuran-2-yl)-6-(3-phenylphenyl)-1,3,5-triazine |
| SMILES | Clc1nc(-c2cccc(-c3ccccc3)c2)nc(-c2ccc3oc4cccc(-c5ccccc5)c4c3c2)n1 |
| InChI | InChI=1S/C33H20ClN3O/c34-33-36-31(24-14-7-13-23(19-24)21-9-3-1-4-10-21)35-32(37-33)25-17-18-28-27(20-25)30-26(15-8-16-29(30)38-28)22-11-5-2-6-12-22/h1-20H |
| InChIKey | DJDLIENRUPWPIN-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.00 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |