C8H9NO2S — CID 170306815
2,3,4,5-tetrahydrothiopyrano[2,3-c]pyridine-6,8-dione (PubChem CID 170306815) has the molecular formula C8H9NO2S and a molecular weight of 183.23 g/mol. Its IUPAC name is 2,3,4,5-tetrahydrothiopyrano[2,3-c]pyridine-6,8-dione.
| Compound Name | 2,3,4,5-tetrahydrothiopyrano[2,3-c]pyridine-6,8-dione |
|---|---|
| PubChem CID | 170306815 |
| Molecular Formula | C8H9NO2S |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | 2,3,4,5-tetrahydrothiopyrano[2,3-c]pyridine-6,8-dione |
| SMILES | O=C1CC2=C(SCCC2)C(=O)N1 |
| InChI | InChI=1S/C8H9NO2S/c10-6-4-5-2-1-3-12-7(5)8(11)9-6/h1-4H2,(H,9,10,11) |
| InChIKey | UNYYTZZSDKIAMT-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|