C12H8F4N3O2S- — CID 170307017
[5-(3,5-difluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-difluoromethanesulfinate (PubChem CID 170307017) has the molecular formula C12H8F4N3O2S- and a molecular weight of 334.27 g/mol. Its IUPAC name is [5-(3,5-difluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-difluoromethanesulfinate.
| Compound Name | [5-(3,5-difluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-difluoromethanesulfinate |
|---|---|
| PubChem CID | 170307017 |
| Molecular Formula | C12H8F4N3O2S- |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | [5-(3,5-difluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-difluoromethanesulfinate |
| SMILES | O=S([O-])C(F)(F)c1nc2n(n1)C(c1cc(F)cc(F)c1)CC2 |
| InChI | InChI=1S/C12H9F4N3O2S/c13-7-3-6(4-8(14)5-7)9-1-2-10-17-11(18-19(9)10)12(15,16)22(20)21/h3-5,9H,1-2H2,(H,20,21)/p-1 |
| InChIKey | URTDADWZNOYLPX-UHFFFAOYSA-M |
| XLogP | 2.02 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|