About 2-sulfanylpropanoic acid;3-thiabicyclo[3.3.1]nona-1(8),5(9),6-triene-2-thione
2-sulfanylpropanoic acid;3-thiabicyclo[3.3.1]nona-1(8),5(9),6-triene-2-thione (PubChem CID 170307681) has the molecular formula C11H12O2S3
and a molecular weight of 272.42 g/mol. Its IUPAC name is 2-sulfanylpropanoic acid;3-thiabicyclo[3.3.1]nona-1(8),5(9),6-triene-2-thione.
Molecular Properties
| Compound Name | 2-sulfanylpropanoic acid;3-thiabicyclo[3.3.1]nona-1(8),5(9),6-triene-2-thione |
| PubChem CID | 170307681 |
| Molecular Formula | C11H12O2S3 |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 2-sulfanylpropanoic acid;3-thiabicyclo[3.3.1]nona-1(8),5(9),6-triene-2-thione |
| SMILES | CC(S)C(=O)O.S=C1SCc2cccc1c2 |
| InChI | InChI=1S/C8H6S2.C3H6O2S/c9-8-7-3-1-2-6(4-7)5-10-8;1-2(6)3(4)5/h1-4H,5H2;2,6H,1H3,(H,4,5) |
| InChIKey | TXIGQBHINGWXPE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ester_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylpropanoic acid;3-thiabicyclo[3.3.1]nona-1(8),5(9),6-triene-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylpropanoic acid;3-thiabicyclo[3.3.1]nona-1(8),5(9),6-triene-2-thione?
The IUPAC name of 2-sulfanylpropanoic acid;3-thiabicyclo[3.3.1]nona-1(8),5(9),6-triene-2-thione (CID 170307681) is 2-sulfanylpropanoic acid;3-thiabicyclo[3.3.1]nona-1(8),5(9),6-triene-2-thione.
What is the SMILES notation for 2-sulfanylpropanoic acid;3-thiabicyclo[3.3.1]nona-1(8),5(9),6-triene-2-thione?
The canonical SMILES for 2-sulfanylpropanoic acid;3-thiabicyclo[3.3.1]nona-1(8),5(9),6-triene-2-thione is CC(S)C(=O)O.S=C1SCc2cccc1c2.
What is the InChIKey of 2-sulfanylpropanoic acid;3-thiabicyclo[3.3.1]nona-1(8),5(9),6-triene-2-thione?
The InChIKey is TXIGQBHINGWXPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6S2.C3H6O2S/c9-8-7-3-1-2-6(4-7)5-10-8;1-2(6)3(4)5/h1-4H,5H2;2,6H,1H3,(H,4,5).
What are the key properties of 2-sulfanylpropanoic acid;3-thiabicyclo[3.3.1]nona-1(8),5(9),6-triene-2-thione?
2-sulfanylpropanoic acid;3-thiabicyclo[3.3.1]nona-1(8),5(9),6-triene-2-thione has a molecular weight of 272.42 g/mol, XLogP of 3.00, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylpropanoic acid;3-thiabicyclo[3.3.1]nona-1(8),5(9),6-triene-2-thione is sourced from PubChem (CID 170307681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).