C24H33N7O3 — CID 170307735
5-(dimethylamino)-6-ethyl-3-[3-[2-[2-[methyl(prop-2-enoyl)amino]propanoylamino]ethyl]anilino]pyrazine-2-carboxamide (PubChem CID 170307735) has the molecular formula C24H33N7O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 5-(dimethylamino)-6-ethyl-3-[3-[2-[2-[methyl(prop-2-enoyl)amino]propanoylamino]ethyl]anilino]pyrazine-2-carboxamide.
| Compound Name | 5-(dimethylamino)-6-ethyl-3-[3-[2-[2-[methyl(prop-2-enoyl)amino]propanoylamino]ethyl]anilino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 170307735 |
| Molecular Formula | C24H33N7O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 5-(dimethylamino)-6-ethyl-3-[3-[2-[2-[methyl(prop-2-enoyl)amino]propanoylamino]ethyl]anilino]pyrazine-2-carboxamide |
| SMILES | C=CC(=O)N(C)C(C)C(=O)NCCc1cccc(Nc2nc(N(C)C)c(CC)nc2C(N)=O)c1 |
| InChI | InChI=1S/C24H33N7O3/c1-7-18-23(30(4)5)29-22(20(28-18)21(25)33)27-17-11-9-10-16(14-17)12-13-26-24(34)15(3)31(6)19(32)8-2/h8-11,14-15H,2,7,12-13H2,1,3-6H3,(H2,25,33)(H,26,34)(H,27,29) |
| InChIKey | JBHCEAMXFIKTHM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|