About CID 170307924
CID 170307924 (PubChem CID 170307924) has the molecular formula C8H7FNaO2
and a molecular weight of 177.13 g/mol.
Molecular Properties
| Compound Name | CID 170307924 |
| PubChem CID | 170307924 |
| Molecular Formula | C8H7FNaO2 |
| Molecular Weight | 177.13 g/mol |
| Exact Mass | 177.03 |
| IUPAC Name | — |
| SMILES | COC(=O)c1ccc(F)cc1.[Na] |
| InChI | InChI=1S/C8H7FO2.Na/c1-11-8(10)6-2-4-7(9)5-3-6;/h2-5H,1H3; |
| InChIKey | RAKWMIJCWSKSJX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.13 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 170307924 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170307924?
The IUPAC name of CID 170307924 (CID 170307924) is not available.
What is the SMILES notation for CID 170307924?
The canonical SMILES for CID 170307924 is COC(=O)c1ccc(F)cc1.[Na].
What is the InChIKey of CID 170307924?
The InChIKey is RAKWMIJCWSKSJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FO2.Na/c1-11-8(10)6-2-4-7(9)5-3-6;/h2-5H,1H3;.
What are the key properties of CID 170307924?
CID 170307924 has a molecular weight of 177.13 g/mol, XLogP of 1.23, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170307924 is sourced from PubChem (CID 170307924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).