C31H36F2N6O — CID 170308066
1-[4-[2-[3-[difluoro(piperidin-4-yl)methyl]phenyl]ethylamino]-7-hex-5-enoxypyrido[2,3-d]pyrimidin-6-yl]cyclopropane-1-carbonitrile (PubChem CID 170308066) has the molecular formula C31H36F2N6O and a molecular weight of 546.67 g/mol. Its IUPAC name is 1-[4-[2-[3-[difluoro(piperidin-4-yl)methyl]phenyl]ethylamino]-7-hex-5-enoxypyrido[2,3-d]pyrimidin-6-yl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[4-[2-[3-[difluoro(piperidin-4-yl)methyl]phenyl]ethylamino]-7-hex-5-enoxypyrido[2,3-d]pyrimidin-6-yl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 170308066 |
| Molecular Formula | C31H36F2N6O |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | 1-[4-[2-[3-[difluoro(piperidin-4-yl)methyl]phenyl]ethylamino]-7-hex-5-enoxypyrido[2,3-d]pyrimidin-6-yl]cyclopropane-1-carbonitrile |
| SMILES | C=CCCCCOc1nc2ncnc(NCCc3cccc(C(F)(F)C4CCNCC4)c3)c2cc1C1(C#N)CC1 |
| InChI | InChI=1S/C31H36F2N6O/c1-2-3-4-5-17-40-29-26(30(20-34)12-13-30)19-25-27(37-21-38-28(25)39-29)36-16-9-22-7-6-8-24(18-22)31(32,33)23-10-14-35-15-11-23/h2,6-8,18-19,21,23,35H,1,3-5,9-17H2,(H,36,37,38,39) |
| InChIKey | NKWYBIOKOZGTAH-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|