C26H27ClN2O6S — CID 170308429
2-[5-[[4-chloro-2-[(furan-2-ylmethylamino)methyl]phenyl]-ethylsulfamoyl]-3-methyl-1-benzofuran-2-yl]ethyl formate (PubChem CID 170308429) has the molecular formula C26H27ClN2O6S and a molecular weight of 531.03 g/mol. Its IUPAC name is 2-[5-[[4-chloro-2-[(furan-2-ylmethylamino)methyl]phenyl]-ethylsulfamoyl]-3-methyl-1-benzofuran-2-yl]ethyl formate.
| Compound Name | 2-[5-[[4-chloro-2-[(furan-2-ylmethylamino)methyl]phenyl]-ethylsulfamoyl]-3-methyl-1-benzofuran-2-yl]ethyl formate |
|---|---|
| PubChem CID | 170308429 |
| Molecular Formula | C26H27ClN2O6S |
| Molecular Weight | 531.03 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | 2-[5-[[4-chloro-2-[(furan-2-ylmethylamino)methyl]phenyl]-ethylsulfamoyl]-3-methyl-1-benzofuran-2-yl]ethyl formate |
| SMILES | CCN(c1ccc(Cl)cc1CNCc1ccco1)S(=O)(=O)c1ccc2oc(CCOC=O)c(C)c2c1 |
| InChI | InChI=1S/C26H27ClN2O6S/c1-3-29(24-8-6-20(27)13-19(24)15-28-16-21-5-4-11-34-21)36(31,32)22-7-9-26-23(14-22)18(2)25(35-26)10-12-33-17-30/h4-9,11,13-14,17,28H,3,10,12,15-16H2,1-2H3 |
| InChIKey | PLESWFCUJBCYFM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.03 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|