C25H31ClF3N3O5 — CID 170308585
(2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]morpholine-2-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 170308585) has the molecular formula C25H31ClF3N3O5 and a molecular weight of 545.99 g/mol. Its IUPAC name is (2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]morpholine-2-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]morpholine-2-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 170308585 |
| Molecular Formula | C25H31ClF3N3O5 |
| Molecular Weight | 545.99 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | (2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]morpholine-2-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(C2CCC(N3C[C@H](C(=O)O)OC[C@@H]3Cc3ccc(Cl)cc3)CC2)nn1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H30ClN3O3.C2HF3O2/c1-15-11-21(25-26(15)2)17-5-9-19(10-6-17)27-13-22(23(28)29)30-14-20(27)12-16-3-7-18(24)8-4-16;3-2(4,5)1(6)7/h3-4,7-8,11,17,19-20,22H,5-6,9-10,12-14H2,1-2H3,(H,28,29);(H,6,7)/t17?,19?,20-,22+;/m0./s1 |
| InChIKey | YBBVYKQDXCYZGE-CFUYIJMKSA-N |
| XLogP | 4.44 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.99 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |