C23H26ClF3N4O4 — CID 170308599
(2,2,2-trifluoroacetyl) (2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(1-methyltriazol-4-yl)cyclohexyl]morpholine-2-carboxylate (PubChem CID 170308599) has the molecular formula C23H26ClF3N4O4 and a molecular weight of 514.93 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(1-methyltriazol-4-yl)cyclohexyl]morpholine-2-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) (2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(1-methyltriazol-4-yl)cyclohexyl]morpholine-2-carboxylate |
|---|---|
| PubChem CID | 170308599 |
| Molecular Formula | C23H26ClF3N4O4 |
| Molecular Weight | 514.93 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(1-methyltriazol-4-yl)cyclohexyl]morpholine-2-carboxylate |
| SMILES | Cn1cc(C2CCC(N3C[C@H](C(=O)OC(=O)C(F)(F)F)OC[C@@H]3Cc3ccc(Cl)cc3)CC2)nn1 |
| InChI | InChI=1S/C23H26ClF3N4O4/c1-30-11-19(28-29-30)15-4-8-17(9-5-15)31-12-20(21(32)35-22(33)23(25,26)27)34-13-18(31)10-14-2-6-16(24)7-3-14/h2-3,6-7,11,15,17-18,20H,4-5,8-10,12-13H2,1H3/t15?,17?,18-,20+/m0/s1 |
| InChIKey | LNUJSYGNOGRVIZ-CCWWBTDTSA-N |
| XLogP | 3.44 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.93 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|