C27H35ClF3N5O5 — CID 170308644
(2R,5S)-N'-acetyl-5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]morpholine-2-carbohydrazide;2,2,2-trifluoroacetic acid (PubChem CID 170308644) has the molecular formula C27H35ClF3N5O5 and a molecular weight of 602.05 g/mol. Its IUPAC name is (2R,5S)-N'-acetyl-5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]morpholine-2-carbohydrazide;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,5S)-N'-acetyl-5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]morpholine-2-carbohydrazide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 170308644 |
| Molecular Formula | C27H35ClF3N5O5 |
| Molecular Weight | 602.05 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | (2R,5S)-N'-acetyl-5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]morpholine-2-carbohydrazide;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)NNC(=O)[C@H]1CN(C2CCC(c3cc(C)n(C)n3)CC2)[C@@H](Cc2ccc(Cl)cc2)CO1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H34ClN5O3.C2HF3O2/c1-16-12-23(29-30(16)3)19-6-10-21(11-7-19)31-14-24(25(33)28-27-17(2)32)34-15-22(31)13-18-4-8-20(26)9-5-18;3-2(4,5)1(6)7/h4-5,8-9,12,19,21-22,24H,6-7,10-11,13-15H2,1-3H3,(H,27,32)(H,28,33);(H,6,7)/t19?,21?,22-,24+;/m0./s1 |
| InChIKey | MMGSFTFPZNKNBL-FXHZXLKNSA-N |
| XLogP | 3.52 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.05 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|