C29H36ClF3N4O5 — CID 170308654
1-[[(2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]morpholin-2-yl]methyl]pyrrolidine-2,5-dione;2,2,2-trifluoroacetic acid (PubChem CID 170308654) has the molecular formula C29H36ClF3N4O5 and a molecular weight of 613.08 g/mol. Its IUPAC name is 1-[[(2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]morpholin-2-yl]methyl]pyrrolidine-2,5-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[[(2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]morpholin-2-yl]methyl]pyrrolidine-2,5-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 170308654 |
| Molecular Formula | C29H36ClF3N4O5 |
| Molecular Weight | 613.08 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | 1-[[(2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-3-yl)cyclohexyl]morpholin-2-yl]methyl]pyrrolidine-2,5-dione;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(C2CCC(N3C[C@H](CN4C(=O)CCC4=O)OC[C@@H]3Cc3ccc(Cl)cc3)CC2)nn1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H35ClN4O3.C2HF3O2/c1-18-13-25(29-30(18)2)20-5-9-22(10-6-20)31-15-24(16-32-26(33)11-12-27(32)34)35-17-23(31)14-19-3-7-21(28)8-4-19;3-2(4,5)1(6)7/h3-4,7-8,13,20,22-24H,5-6,9-12,14-17H2,1-2H3;(H,6,7)/t20?,22?,23-,24+;/m0./s1 |
| InChIKey | DGEWRRLKODAFCB-DGEDSRRFSA-N |
| XLogP | 4.50 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.08 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|