C26H35ClF3N3O5S — CID 170308656
(2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-4-yl)cyclohexyl]-2-(methylsulfonylmethyl)morpholine;2,2,2-trifluoroacetic acid (PubChem CID 170308656) has the molecular formula C26H35ClF3N3O5S and a molecular weight of 594.10 g/mol. Its IUPAC name is (2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-4-yl)cyclohexyl]-2-(methylsulfonylmethyl)morpholine;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-4-yl)cyclohexyl]-2-(methylsulfonylmethyl)morpholine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 170308656 |
| Molecular Formula | C26H35ClF3N3O5S |
| Molecular Weight | 594.10 g/mol |
| Exact Mass | 593.19 |
| IUPAC Name | (2R,5S)-5-[(4-chlorophenyl)methyl]-4-[4-(1,5-dimethylpyrazol-4-yl)cyclohexyl]-2-(methylsulfonylmethyl)morpholine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1c(C2CCC(N3C[C@H](CS(C)(=O)=O)OC[C@@H]3Cc3ccc(Cl)cc3)CC2)cnn1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H34ClN3O3S.C2HF3O2/c1-17-24(13-26-27(17)2)19-6-10-21(11-7-19)28-14-23(16-32(3,29)30)31-15-22(28)12-18-4-8-20(25)9-5-18;3-2(4,5)1(6)7/h4-5,8-9,13,19,21-23H,6-7,10-12,14-16H2,1-3H3;(H,6,7)/t19?,21?,22-,23+;/m0./s1 |
| InChIKey | RSEBKRZVBLHHKE-VQKIPTDDSA-N |
| XLogP | 4.40 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.10 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |