C13H20N2O4 — CID 170310396
1-(5-ethyl-3,6-dimethoxy-2-pyridinyl)propan-2-ylcarbamic acid (PubChem CID 170310396) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 1-(5-ethyl-3,6-dimethoxy-2-pyridinyl)propan-2-ylcarbamic acid.
| Compound Name | 1-(5-ethyl-3,6-dimethoxy-2-pyridinyl)propan-2-ylcarbamic acid |
|---|---|
| PubChem CID | 170310396 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 1-(5-ethyl-3,6-dimethoxy-2-pyridinyl)propan-2-ylcarbamic acid |
| SMILES | CCc1cc(OC)c(CC(C)NC(=O)O)nc1OC |
| InChI | InChI=1S/C13H20N2O4/c1-5-9-7-11(18-3)10(15-12(9)19-4)6-8(2)14-13(16)17/h7-8,14H,5-6H2,1-4H3,(H,16,17) |
| InChIKey | CCUCNWUCMOVCOQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |