C12H24N2 — CID 170310902
1-propan-2-yl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-2-amine (PubChem CID 170310902) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 1-propan-2-yl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-2-amine.
| Compound Name | 1-propan-2-yl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-2-amine |
|---|---|
| PubChem CID | 170310902 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 1-propan-2-yl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-2-amine |
| SMILES | CC(C)N1C(N)CCC2CCCCC21 |
| InChI | InChI=1S/C12H24N2/c1-9(2)14-11-6-4-3-5-10(11)7-8-12(14)13/h9-12H,3-8,13H2,1-2H3 |
| InChIKey | XQQWYQDLPLDAPQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |