C19H18F2N4 — CID 170311206
5-[5-(2-fluoroethyl)-3-pyridinyl]-N-[1-(4-fluorophenyl)ethyl]pyrazin-2-amine (PubChem CID 170311206) has the molecular formula C19H18F2N4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 5-[5-(2-fluoroethyl)-3-pyridinyl]-N-[1-(4-fluorophenyl)ethyl]pyrazin-2-amine.
| Compound Name | 5-[5-(2-fluoroethyl)-3-pyridinyl]-N-[1-(4-fluorophenyl)ethyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 170311206 |
| Molecular Formula | C19H18F2N4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 5-[5-(2-fluoroethyl)-3-pyridinyl]-N-[1-(4-fluorophenyl)ethyl]pyrazin-2-amine |
| SMILES | CC(Nc1cnc(-c2cncc(CCF)c2)cn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H18F2N4/c1-13(15-2-4-17(21)5-3-15)25-19-12-23-18(11-24-19)16-8-14(6-7-20)9-22-10-16/h2-5,8-13H,6-7H2,1H3,(H,24,25) |
| InChIKey | NXACRJNOZZDWST-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |