C21H22N8O2S — CID 170311357
N-(1-cyanocyclopropyl)-4-[(3S)-4-(cyanomethyl)-3-methylpiperazin-1-yl]-9H-pyrimido[4,5-b]indole-7-sulfonamide (PubChem CID 170311357) has the molecular formula C21H22N8O2S and a molecular weight of 450.53 g/mol. Its IUPAC name is N-(1-cyanocyclopropyl)-4-[(3S)-4-(cyanomethyl)-3-methylpiperazin-1-yl]-9H-pyrimido[4,5-b]indole-7-sulfonamide.
| Compound Name | N-(1-cyanocyclopropyl)-4-[(3S)-4-(cyanomethyl)-3-methylpiperazin-1-yl]-9H-pyrimido[4,5-b]indole-7-sulfonamide |
|---|---|
| PubChem CID | 170311357 |
| Molecular Formula | C21H22N8O2S |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | N-(1-cyanocyclopropyl)-4-[(3S)-4-(cyanomethyl)-3-methylpiperazin-1-yl]-9H-pyrimido[4,5-b]indole-7-sulfonamide |
| SMILES | C[C@H]1CN(c2ncnc3[nH]c4cc(S(=O)(=O)NC5(C#N)CC5)ccc4c23)CCN1CC#N |
| InChI | InChI=1S/C21H22N8O2S/c1-14-11-29(9-8-28(14)7-6-22)20-18-16-3-2-15(10-17(16)26-19(18)24-13-25-20)32(30,31)27-21(12-23)4-5-21/h2-3,10,13-14,27H,4-5,7-9,11H2,1H3,(H,24,25,26)/t14-/m0/s1 |
| InChIKey | PRZIFLIPSWYEDN-AWEZNQCLSA-N |
| XLogP | 1.48 |
| TPSA | 141.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|