About 5-chloro-2-(7-fluoro-3,4-dihydro-2H-chromen-4-yl)-4-(trifluoromethyl)benzoyl chloride
5-chloro-2-(7-fluoro-3,4-dihydro-2H-chromen-4-yl)-4-(trifluoromethyl)benzoyl chloride (PubChem CID 170311599) has the molecular formula C17H10Cl2F4O2
and a molecular weight of 393.16 g/mol. Its IUPAC name is 5-chloro-2-(7-fluoro-3,4-dihydro-2H-chromen-4-yl)-4-(trifluoromethyl)benzoyl chloride.
Molecular Properties
| Compound Name | 5-chloro-2-(7-fluoro-3,4-dihydro-2H-chromen-4-yl)-4-(trifluoromethyl)benzoyl chloride |
| PubChem CID | 170311599 |
| Molecular Formula | C17H10Cl2F4O2 |
| Molecular Weight | 393.16 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | 5-chloro-2-(7-fluoro-3,4-dihydro-2H-chromen-4-yl)-4-(trifluoromethyl)benzoyl chloride |
| SMILES | O=C(Cl)c1cc(Cl)c(C(F)(F)F)cc1C1CCOc2cc(F)ccc21 |
| InChI | InChI=1S/C17H10Cl2F4O2/c18-14-7-12(16(19)24)11(6-13(14)17(21,22)23)9-3-4-25-15-5-8(20)1-2-10(9)15/h1-2,5-7,9H,3-4H2 |
| InChIKey | WGEDBYRGWLQOIG-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.16 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-(7-fluoro-3,4-dihydro-2H-chromen-4-yl)-4-(trifluoromethyl)benzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(7-fluoro-3,4-dihydro-2H-chromen-4-yl)-4-(trifluoromethyl)benzoyl chloride?
The IUPAC name of 5-chloro-2-(7-fluoro-3,4-dihydro-2H-chromen-4-yl)-4-(trifluoromethyl)benzoyl chloride (CID 170311599) is 5-chloro-2-(7-fluoro-3,4-dihydro-2H-chromen-4-yl)-4-(trifluoromethyl)benzoyl chloride.
What is the SMILES notation for 5-chloro-2-(7-fluoro-3,4-dihydro-2H-chromen-4-yl)-4-(trifluoromethyl)benzoyl chloride?
The canonical SMILES for 5-chloro-2-(7-fluoro-3,4-dihydro-2H-chromen-4-yl)-4-(trifluoromethyl)benzoyl chloride is O=C(Cl)c1cc(Cl)c(C(F)(F)F)cc1C1CCOc2cc(F)ccc21.
What is the InChIKey of 5-chloro-2-(7-fluoro-3,4-dihydro-2H-chromen-4-yl)-4-(trifluoromethyl)benzoyl chloride?
The InChIKey is WGEDBYRGWLQOIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10Cl2F4O2/c18-14-7-12(16(19)24)11(6-13(14)17(21,22)23)9-3-4-25-15-5-8(20)1-2-10(9)15/h1-2,5-7,9H,3-4H2.
What are the key properties of 5-chloro-2-(7-fluoro-3,4-dihydro-2H-chromen-4-yl)-4-(trifluoromethyl)benzoyl chloride?
5-chloro-2-(7-fluoro-3,4-dihydro-2H-chromen-4-yl)-4-(trifluoromethyl)benzoyl chloride has a molecular weight of 393.16 g/mol, XLogP of 5.79, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(7-fluoro-3,4-dihydro-2H-chromen-4-yl)-4-(trifluoromethyl)benzoyl chloride is sourced from PubChem (CID 170311599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).