C15H16ClF3N4O3S — CID 170311651
N-(5-amino-6-chloro-3-pyridinyl)-2-tert-butyl-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 170311651) has the molecular formula C15H16ClF3N4O3S and a molecular weight of 424.83 g/mol. Its IUPAC name is N-(5-amino-6-chloro-3-pyridinyl)-2-tert-butyl-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(5-amino-6-chloro-3-pyridinyl)-2-tert-butyl-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 170311651 |
| Molecular Formula | C15H16ClF3N4O3S |
| Molecular Weight | 424.83 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | N-(5-amino-6-chloro-3-pyridinyl)-2-tert-butyl-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)(C)c1nc(C(=O)Nc2cnc(Cl)c(N)c2)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H15ClN4OS.C2HF3O2/c1-13(2,3)12-18-9(6-20-12)11(19)17-7-4-8(15)10(14)16-5-7;3-2(4,5)1(6)7/h4-6H,15H2,1-3H3,(H,17,19);(H,6,7) |
| InChIKey | WPPPNNQXSUBYBT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.83 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|