C23H22F4N2O2 — CID 170312147
8-[(2,3-difluorophenyl)methyl]-2-[(2,6-difluorophenyl)methyl]-2,8-diazaspiro[5.5]undecane-1,7-dione (PubChem CID 170312147) has the molecular formula C23H22F4N2O2 and a molecular weight of 434.43 g/mol. Its IUPAC name is 8-[(2,3-difluorophenyl)methyl]-2-[(2,6-difluorophenyl)methyl]-2,8-diazaspiro[5.5]undecane-1,7-dione.
| Compound Name | 8-[(2,3-difluorophenyl)methyl]-2-[(2,6-difluorophenyl)methyl]-2,8-diazaspiro[5.5]undecane-1,7-dione |
|---|---|
| PubChem CID | 170312147 |
| Molecular Formula | C23H22F4N2O2 |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 8-[(2,3-difluorophenyl)methyl]-2-[(2,6-difluorophenyl)methyl]-2,8-diazaspiro[5.5]undecane-1,7-dione |
| SMILES | O=C1N(Cc2cccc(F)c2F)CCCC12CCCN(Cc1c(F)cccc1F)C2=O |
| InChI | InChI=1S/C23H22F4N2O2/c24-17-6-2-7-18(25)16(17)14-29-12-4-10-23(22(29)31)9-3-11-28(21(23)30)13-15-5-1-8-19(26)20(15)27/h1-2,5-8H,3-4,9-14H2 |
| InChIKey | XUDGNXHTMGLAGB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|