About 1,5-dihydropyrido[2,3-c]azepin-2-one;hydrochloride
1,5-dihydropyrido[2,3-c]azepin-2-one;hydrochloride (PubChem CID 170312438) has the molecular formula C9H9ClN2O
and a molecular weight of 196.64 g/mol. Its IUPAC name is 1,5-dihydropyrido[2,3-c]azepin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 1,5-dihydropyrido[2,3-c]azepin-2-one;hydrochloride |
| PubChem CID | 170312438 |
| Molecular Formula | C9H9ClN2O |
| Molecular Weight | 196.64 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 1,5-dihydropyrido[2,3-c]azepin-2-one;hydrochloride |
| SMILES | Cl.O=c1ccc2c([nH]1)C=NC=CC2 |
| InChI | InChI=1S/C9H8N2O.ClH/c12-9-4-3-7-2-1-5-10-6-8(7)11-9;/h1,3-6H,2H2,(H,11,12);1H |
| InChIKey | LLUOCNMWACWQOU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 45.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.64 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,5-dihydropyrido[2,3-c]azepin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dihydropyrido[2,3-c]azepin-2-one;hydrochloride?
The IUPAC name of 1,5-dihydropyrido[2,3-c]azepin-2-one;hydrochloride (CID 170312438) is 1,5-dihydropyrido[2,3-c]azepin-2-one;hydrochloride.
What is the SMILES notation for 1,5-dihydropyrido[2,3-c]azepin-2-one;hydrochloride?
The canonical SMILES for 1,5-dihydropyrido[2,3-c]azepin-2-one;hydrochloride is Cl.O=c1ccc2c([nH]1)C=NC=CC2.
What is the InChIKey of 1,5-dihydropyrido[2,3-c]azepin-2-one;hydrochloride?
The InChIKey is LLUOCNMWACWQOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O.ClH/c12-9-4-3-7-2-1-5-10-6-8(7)11-9;/h1,3-6H,2H2,(H,11,12);1H.
What are the key properties of 1,5-dihydropyrido[2,3-c]azepin-2-one;hydrochloride?
1,5-dihydropyrido[2,3-c]azepin-2-one;hydrochloride has a molecular weight of 196.64 g/mol, XLogP of 1.29, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dihydropyrido[2,3-c]azepin-2-one;hydrochloride is sourced from PubChem (CID 170312438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).