About tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;4-(3-hydroxybutyl)piperidine-1-carboxylic acid
tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;4-(3-hydroxybutyl)piperidine-1-carboxylic acid (PubChem CID 170313084) has the molecular formula C24H46N2O6
and a molecular weight of 458.64 g/mol. Its IUPAC name is tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;4-(3-hydroxybutyl)piperidine-1-carboxylic acid.
Molecular Properties
| Compound Name | tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;4-(3-hydroxybutyl)piperidine-1-carboxylic acid |
| PubChem CID | 170313084 |
| Molecular Formula | C24H46N2O6 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;4-(3-hydroxybutyl)piperidine-1-carboxylic acid |
| SMILES | CC(O)CCC1CCN(C(=O)O)CC1.CC(O)CCC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H27NO3.C10H19NO3/c1-11(16)5-6-12-7-9-15(10-8-12)13(17)18-14(2,3)4;1-8(12)2-3-9-4-6-11(7-5-9)10(13)14/h11-12,16H,5-10H2,1-4H3;8-9,12H,2-7H2,1H3,(H,13,14) |
| InChIKey | KCEYPMGYJRJATC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;4-(3-hydroxybutyl)piperidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;4-(3-hydroxybutyl)piperidine-1-carboxylic acid?
The IUPAC name of tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;4-(3-hydroxybutyl)piperidine-1-carboxylic acid (CID 170313084) is tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;4-(3-hydroxybutyl)piperidine-1-carboxylic acid.
What is the SMILES notation for tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;4-(3-hydroxybutyl)piperidine-1-carboxylic acid?
The canonical SMILES for tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;4-(3-hydroxybutyl)piperidine-1-carboxylic acid is CC(O)CCC1CCN(C(=O)O)CC1.CC(O)CCC1CCN(C(=O)OC(C)(C)C)CC1.
What is the InChIKey of tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;4-(3-hydroxybutyl)piperidine-1-carboxylic acid?
The InChIKey is KCEYPMGYJRJATC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO3.C10H19NO3/c1-11(16)5-6-12-7-9-15(10-8-12)13(17)18-14(2,3)4;1-8(12)2-3-9-4-6-11(7-5-9)10(13)14/h11-12,16H,5-10H2,1-4H3;8-9,12H,2-7H2,1H3,(H,13,14).
What are the key properties of tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;4-(3-hydroxybutyl)piperidine-1-carboxylic acid?
tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;4-(3-hydroxybutyl)piperidine-1-carboxylic acid has a molecular weight of 458.64 g/mol, XLogP of 4.33, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(3-hydroxybutyl)piperidine-1-carboxylate;4-(3-hydroxybutyl)piperidine-1-carboxylic acid is sourced from PubChem (CID 170313084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).