C20H22F3N5O4 — CID 170313763
(3R,4S)-4-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]amino]-3-(trifluoromethyl)piperidine-1-carboxylic acid (PubChem CID 170313763) has the molecular formula C20H22F3N5O4 and a molecular weight of 453.42 g/mol. Its IUPAC name is (3R,4S)-4-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]amino]-3-(trifluoromethyl)piperidine-1-carboxylic acid.
| Compound Name | (3R,4S)-4-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]amino]-3-(trifluoromethyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 170313763 |
| Molecular Formula | C20H22F3N5O4 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | (3R,4S)-4-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]amino]-3-(trifluoromethyl)piperidine-1-carboxylic acid |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2ccc(N[C@H]3CCN(C(=O)O)C[C@H]3C(F)(F)F)cc21 |
| InChI | InChI=1S/C20H22F3N5O4/c1-27-15-8-10(24-14-6-7-28(19(31)32)9-13(14)20(21,22)23)2-3-11(15)17(26-27)12-4-5-16(29)25-18(12)30/h2-3,8,12-14,24H,4-7,9H2,1H3,(H,31,32)(H,25,29,30)/t12?,13-,14+/m1/s1 |
| InChIKey | ZUEOYMJXDMIOGT-IUZLNWEFSA-N |
| XLogP | 2.44 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|