About 6-(methoxymethoxy)-1,8-dimethyl-2,3-dihydronaphthalene
6-(methoxymethoxy)-1,8-dimethyl-2,3-dihydronaphthalene (PubChem CID 170314610) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is 6-(methoxymethoxy)-1,8-dimethyl-2,3-dihydronaphthalene.
Molecular Properties
| Compound Name | 6-(methoxymethoxy)-1,8-dimethyl-2,3-dihydronaphthalene |
| PubChem CID | 170314610 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 6-(methoxymethoxy)-1,8-dimethyl-2,3-dihydronaphthalene |
| SMILES | COCOc1cc(C)c2c(c1)=CCCC=2C |
| InChI | InChI=1S/C14H18O2/c1-10-5-4-6-12-8-13(16-9-15-3)7-11(2)14(10)12/h6-8H,4-5,9H2,1-3H3 |
| InChIKey | GLOZJZLPUFCZPY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6-(methoxymethoxy)-1,8-dimethyl-2,3-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(methoxymethoxy)-1,8-dimethyl-2,3-dihydronaphthalene?
The IUPAC name of 6-(methoxymethoxy)-1,8-dimethyl-2,3-dihydronaphthalene (CID 170314610) is 6-(methoxymethoxy)-1,8-dimethyl-2,3-dihydronaphthalene.
What is the SMILES notation for 6-(methoxymethoxy)-1,8-dimethyl-2,3-dihydronaphthalene?
The canonical SMILES for 6-(methoxymethoxy)-1,8-dimethyl-2,3-dihydronaphthalene is COCOc1cc(C)c2c(c1)=CCCC=2C.
What is the InChIKey of 6-(methoxymethoxy)-1,8-dimethyl-2,3-dihydronaphthalene?
The InChIKey is GLOZJZLPUFCZPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O2/c1-10-5-4-6-12-8-13(16-9-15-3)7-11(2)14(10)12/h6-8H,4-5,9H2,1-3H3.
What are the key properties of 6-(methoxymethoxy)-1,8-dimethyl-2,3-dihydronaphthalene?
6-(methoxymethoxy)-1,8-dimethyl-2,3-dihydronaphthalene has a molecular weight of 218.30 g/mol, XLogP of 1.72, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(methoxymethoxy)-1,8-dimethyl-2,3-dihydronaphthalene is sourced from PubChem (CID 170314610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).