C26H29ClFN5O6 — CID 170314755
2-[[[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-(2-fluoroprop-2-enoyl)amino]acetic acid (PubChem CID 170314755) has the molecular formula C26H29ClFN5O6 and a molecular weight of 562.00 g/mol. Its IUPAC name is 2-[[[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-(2-fluoroprop-2-enoyl)amino]acetic acid.
| Compound Name | 2-[[[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-(2-fluoroprop-2-enoyl)amino]acetic acid |
|---|---|
| PubChem CID | 170314755 |
| Molecular Formula | C26H29ClFN5O6 |
| Molecular Weight | 562.00 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | 2-[[[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-(2-fluoroprop-2-enoyl)amino]acetic acid |
| SMILES | C=C(F)C(=O)N(CC(=O)O)NC(=O)C(NC(=O)[C@@H](NC(=O)c1ccc(N)c(Cl)c1)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C26H29ClFN5O6/c1-14(28)25(39)33(13-19(34)35)32-23(37)20(15-8-6-5-7-9-15)30-24(38)21(26(2,3)4)31-22(36)16-10-11-18(29)17(27)12-16/h5-12,20-21H,1,13,29H2,2-4H3,(H,30,38)(H,31,36)(H,32,37)(H,34,35)/t20?,21-/m1/s1 |
| InChIKey | MUWRDPZXVJFBDH-BPGUCPLFSA-N |
| XLogP | 2.35 |
| TPSA | 170.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.00 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|