C31H30ClF4N5O7 — CID 170314763
2-[[[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-[2-(2,3,5,6-tetrafluorophenoxy)acetyl]amino]acetic acid (PubChem CID 170314763) has the molecular formula C31H30ClF4N5O7 and a molecular weight of 696.05 g/mol. Its IUPAC name is 2-[[[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-[2-(2,3,5,6-tetrafluorophenoxy)acetyl]amino]acetic acid.
| Compound Name | 2-[[[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-[2-(2,3,5,6-tetrafluorophenoxy)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 170314763 |
| Molecular Formula | C31H30ClF4N5O7 |
| Molecular Weight | 696.05 g/mol |
| Exact Mass | 695.18 |
| IUPAC Name | 2-[[[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-[2-(2,3,5,6-tetrafluorophenoxy)acetyl]amino]acetic acid |
| SMILES | CC(C)(C)[C@H](NC(=O)c1ccc(N)c(Cl)c1)C(=O)NC(C(=O)NN(CC(=O)O)C(=O)COc1c(F)c(F)cc(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C31H30ClF4N5O7/c1-31(2,3)27(39-28(45)16-9-10-20(37)17(32)11-16)30(47)38-25(15-7-5-4-6-8-15)29(46)40-41(13-22(43)44)21(42)14-48-26-23(35)18(33)12-19(34)24(26)36/h4-12,25,27H,13-14,37H2,1-3H3,(H,38,47)(H,39,45)(H,40,46)(H,43,44)/t25?,27-/m1/s1 |
| InChIKey | DTDJHWFHWXDFMO-ZCJYOONXSA-N |
| XLogP | 3.50 |
| TPSA | 180.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.05 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|