C33H33ClF5N5O7 — CID 170314769
ethyl 2-[[[(2R)-2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]amino]acetate (PubChem CID 170314769) has the molecular formula C33H33ClF5N5O7 and a molecular weight of 742.10 g/mol. Its IUPAC name is ethyl 2-[[[(2R)-2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]amino]acetate.
| Compound Name | ethyl 2-[[[(2R)-2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]amino]acetate |
|---|---|
| PubChem CID | 170314769 |
| Molecular Formula | C33H33ClF5N5O7 |
| Molecular Weight | 742.10 g/mol |
| Exact Mass | 741.20 |
| IUPAC Name | ethyl 2-[[[(2R)-2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]amino]acetate |
| SMILES | CCOC(=O)CN(NC(=O)[C@H](NC(=O)[C@@H](NC(=O)c1ccc(N)c(Cl)c1)C(C)(C)C)c1ccccc1)C(=O)COc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C33H33ClF5N5O7/c1-5-50-21(46)14-44(20(45)15-51-28-25(38)23(36)22(35)24(37)26(28)39)43-31(48)27(16-9-7-6-8-10-16)41-32(49)29(33(2,3)4)42-30(47)17-11-12-19(40)18(34)13-17/h6-13,27,29H,5,14-15,40H2,1-4H3,(H,41,49)(H,42,47)(H,43,48)/t27-,29-/m1/s1 |
| InChIKey | MUYKEYACTQIZMQ-XRKRLSELSA-N |
| XLogP | 4.12 |
| TPSA | 169.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.10 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|