C18H33N3O4 — CID 170314770
(6aS)-N-[2,4-dimethyl-4-(methylamino)hexan-2-yl]-N,2,2-trimethyl-4-oxo-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-6-carboxamide (PubChem CID 170314770) has the molecular formula C18H33N3O4 and a molecular weight of 355.48 g/mol. Its IUPAC name is (6aS)-N-[2,4-dimethyl-4-(methylamino)hexan-2-yl]-N,2,2-trimethyl-4-oxo-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-6-carboxamide.
| Compound Name | (6aS)-N-[2,4-dimethyl-4-(methylamino)hexan-2-yl]-N,2,2-trimethyl-4-oxo-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-6-carboxamide |
|---|---|
| PubChem CID | 170314770 |
| Molecular Formula | C18H33N3O4 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | (6aS)-N-[2,4-dimethyl-4-(methylamino)hexan-2-yl]-N,2,2-trimethyl-4-oxo-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-6-carboxamide |
| SMILES | CCC(C)(CC(C)(C)N(C)C(=O)C1NC(=O)C2OC(C)(C)O[C@@H]12)NC |
| InChI | InChI=1S/C18H33N3O4/c1-9-18(6,19-7)10-16(2,3)21(8)15(23)11-12-13(14(22)20-11)25-17(4,5)24-12/h11-13,19H,9-10H2,1-8H3,(H,20,22)/t11?,12-,13?,18?/m0/s1 |
| InChIKey | VIEPJYNCDGDWKY-UCASBVRLSA-N |
| XLogP | 1.02 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |