C27H24ClF4N5O7 — CID 170314789
ethyl 2-[[2-[3-[(4-amino-3-chlorobenzoyl)amino]-2-oxo-1-pyridinyl]propanoylamino]-[2-(2,3,5,6-tetrafluorophenoxy)acetyl]amino]acetate (PubChem CID 170314789) has the molecular formula C27H24ClF4N5O7 and a molecular weight of 641.96 g/mol. Its IUPAC name is ethyl 2-[[2-[3-[(4-amino-3-chlorobenzoyl)amino]-2-oxo-1-pyridinyl]propanoylamino]-[2-(2,3,5,6-tetrafluorophenoxy)acetyl]amino]acetate.
| Compound Name | ethyl 2-[[2-[3-[(4-amino-3-chlorobenzoyl)amino]-2-oxo-1-pyridinyl]propanoylamino]-[2-(2,3,5,6-tetrafluorophenoxy)acetyl]amino]acetate |
|---|---|
| PubChem CID | 170314789 |
| Molecular Formula | C27H24ClF4N5O7 |
| Molecular Weight | 641.96 g/mol |
| Exact Mass | 641.13 |
| IUPAC Name | ethyl 2-[[2-[3-[(4-amino-3-chlorobenzoyl)amino]-2-oxo-1-pyridinyl]propanoylamino]-[2-(2,3,5,6-tetrafluorophenoxy)acetyl]amino]acetate |
| SMILES | CCOC(=O)CN(NC(=O)C(C)n1cccc(NC(=O)c2ccc(N)c(Cl)c2)c1=O)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C27H24ClF4N5O7/c1-3-43-21(39)11-37(20(38)12-44-24-22(31)16(29)10-17(30)23(24)32)35-25(40)13(2)36-8-4-5-19(27(36)42)34-26(41)14-6-7-18(33)15(28)9-14/h4-10,13H,3,11-12,33H2,1-2H3,(H,34,41)(H,35,40) |
| InChIKey | AFLIMIMYMMHPFK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 162.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.96 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|