C30H29ClF4N4O7 — CID 170314803
tert-butyl 3-[2-[3-[(4-amino-3-chlorobenzoyl)amino]-2-oxo-1-pyridinyl]propanoylamino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate (PubChem CID 170314803) has the molecular formula C30H29ClF4N4O7 and a molecular weight of 669.03 g/mol. Its IUPAC name is tert-butyl 3-[2-[3-[(4-amino-3-chlorobenzoyl)amino]-2-oxo-1-pyridinyl]propanoylamino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate.
| Compound Name | tert-butyl 3-[2-[3-[(4-amino-3-chlorobenzoyl)amino]-2-oxo-1-pyridinyl]propanoylamino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
|---|---|
| PubChem CID | 170314803 |
| Molecular Formula | C30H29ClF4N4O7 |
| Molecular Weight | 669.03 g/mol |
| Exact Mass | 668.17 |
| IUPAC Name | tert-butyl 3-[2-[3-[(4-amino-3-chlorobenzoyl)amino]-2-oxo-1-pyridinyl]propanoylamino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
| SMILES | CC(C(=O)NC(CC(=O)OC(C)(C)C)C(=O)COc1c(F)c(F)cc(F)c1F)n1cccc(NC(=O)c2ccc(N)c(Cl)c2)c1=O |
| InChI | InChI=1S/C30H29ClF4N4O7/c1-14(39-9-5-6-20(29(39)44)37-28(43)15-7-8-19(36)16(31)10-15)27(42)38-21(12-23(41)46-30(2,3)4)22(40)13-45-26-24(34)17(32)11-18(33)25(26)35/h5-11,14,21H,12-13,36H2,1-4H3,(H,37,43)(H,38,42) |
| InChIKey | ULTLBDNTJRNDGX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.03 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|