C22H25ClF3N5O3 — CID 170314812
4-amino-3-chloro-N-[(2S)-1-[[2-hydrazinyl-2-oxo-1-[3-(trifluoromethyl)phenyl]ethyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]benzamide (PubChem CID 170314812) has the molecular formula C22H25ClF3N5O3 and a molecular weight of 499.92 g/mol. Its IUPAC name is 4-amino-3-chloro-N-[(2S)-1-[[2-hydrazinyl-2-oxo-1-[3-(trifluoromethyl)phenyl]ethyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-amino-3-chloro-N-[(2S)-1-[[2-hydrazinyl-2-oxo-1-[3-(trifluoromethyl)phenyl]ethyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 170314812 |
| Molecular Formula | C22H25ClF3N5O3 |
| Molecular Weight | 499.92 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 4-amino-3-chloro-N-[(2S)-1-[[2-hydrazinyl-2-oxo-1-[3-(trifluoromethyl)phenyl]ethyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)(C)[C@H](NC(=O)c1ccc(N)c(Cl)c1)C(=O)NC(C(=O)NN)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H25ClF3N5O3/c1-21(2,3)17(30-18(32)12-7-8-15(27)14(23)10-12)20(34)29-16(19(33)31-28)11-5-4-6-13(9-11)22(24,25)26/h4-10,16-17H,27-28H2,1-3H3,(H,29,34)(H,30,32)(H,31,33)/t16?,17-/m1/s1 |
| InChIKey | GXXRBKJUJCYLGE-ZYMOGRSISA-N |
| XLogP | 2.93 |
| TPSA | 139.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.92 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|