C24H27ClF3N5O4 — CID 170314827
4-amino-3-chloro-N-[(2S)-3,3-dimethyl-1-oxo-1-[[2-oxo-1-phenyl-2-[2-(3,3,3-trifluoro-2-oxopropyl)hydrazinyl]ethyl]amino]butan-2-yl]benzamide (PubChem CID 170314827) has the molecular formula C24H27ClF3N5O4 and a molecular weight of 541.96 g/mol. Its IUPAC name is 4-amino-3-chloro-N-[(2S)-3,3-dimethyl-1-oxo-1-[[2-oxo-1-phenyl-2-[2-(3,3,3-trifluoro-2-oxopropyl)hydrazinyl]ethyl]amino]butan-2-yl]benzamide.
| Compound Name | 4-amino-3-chloro-N-[(2S)-3,3-dimethyl-1-oxo-1-[[2-oxo-1-phenyl-2-[2-(3,3,3-trifluoro-2-oxopropyl)hydrazinyl]ethyl]amino]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 170314827 |
| Molecular Formula | C24H27ClF3N5O4 |
| Molecular Weight | 541.96 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | 4-amino-3-chloro-N-[(2S)-3,3-dimethyl-1-oxo-1-[[2-oxo-1-phenyl-2-[2-(3,3,3-trifluoro-2-oxopropyl)hydrazinyl]ethyl]amino]butan-2-yl]benzamide |
| SMILES | CC(C)(C)[C@H](NC(=O)c1ccc(N)c(Cl)c1)C(=O)NC(C(=O)NNCC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C24H27ClF3N5O4/c1-23(2,3)19(32-20(35)14-9-10-16(29)15(25)11-14)22(37)31-18(13-7-5-4-6-8-13)21(36)33-30-12-17(34)24(26,27)28/h4-11,18-19,30H,12,29H2,1-3H3,(H,31,37)(H,32,35)(H,33,36)/t18?,19-/m1/s1 |
| InChIKey | MYJWTUIDKNFMNC-MUMRKEEXSA-N |
| XLogP | 2.68 |
| TPSA | 142.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.96 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|