C18H22Cl2N2O — CID 170315356
N-(2,6-dichloro-4-pyridinyl)-2-[(1S,2S)-3-methylidene-2-[(Z)-pent-2-enyl]cyclopentyl]acetamide (PubChem CID 170315356) has the molecular formula C18H22Cl2N2O and a molecular weight of 353.29 g/mol. Its IUPAC name is N-(2,6-dichloro-4-pyridinyl)-2-[(1S,2S)-3-methylidene-2-[(Z)-pent-2-enyl]cyclopentyl]acetamide.
| Compound Name | N-(2,6-dichloro-4-pyridinyl)-2-[(1S,2S)-3-methylidene-2-[(Z)-pent-2-enyl]cyclopentyl]acetamide |
|---|---|
| PubChem CID | 170315356 |
| Molecular Formula | C18H22Cl2N2O |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | N-(2,6-dichloro-4-pyridinyl)-2-[(1S,2S)-3-methylidene-2-[(Z)-pent-2-enyl]cyclopentyl]acetamide |
| SMILES | C=C1CC[C@@H](CC(=O)Nc2cc(Cl)nc(Cl)c2)[C@@H]1C/C=C\CC |
| InChI | InChI=1S/C18H22Cl2N2O/c1-3-4-5-6-15-12(2)7-8-13(15)9-18(23)21-14-10-16(19)22-17(20)11-14/h4-5,10-11,13,15H,2-3,6-9H2,1H3,(H,21,22,23)/b5-4-/t13-,15+/m0/s1 |
| InChIKey | FCZPGPURSJQIDS-LTIZXKLPSA-N |
| XLogP | 5.66 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|