C12H23N — CID 170315466
4-heptan-3-yl-1,2,3,6-tetrahydropyridine (PubChem CID 170315466) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is 4-heptan-3-yl-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-heptan-3-yl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 170315466 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 4-heptan-3-yl-1,2,3,6-tetrahydropyridine |
| SMILES | CCCCC(CC)C1=CCNCC1 |
| InChI | InChI=1S/C12H23N/c1-3-5-6-11(4-2)12-7-9-13-10-8-12/h7,11,13H,3-6,8-10H2,1-2H3 |
| InChIKey | VRNCNZLPWUVWOJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|