About [2-[1-(4,4-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] propanoate
[2-[1-(4,4-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] propanoate (PubChem CID 170316060) has the molecular formula C16H28O3
and a molecular weight of 268.40 g/mol. Its IUPAC name is [2-[1-(4,4-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] propanoate.
Molecular Properties
| Compound Name | [2-[1-(4,4-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] propanoate |
| PubChem CID | 170316060 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | [2-[1-(4,4-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] propanoate |
| SMILES | CCC(=O)OCC(C)(C)OC(C)C1=CCC(C)(C)C1 |
| InChI | InChI=1S/C16H28O3/c1-7-14(17)18-11-16(5,6)19-12(2)13-8-9-15(3,4)10-13/h8,12H,7,9-11H2,1-6H3 |
| InChIKey | CJCVMEQRAQTCNP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-[1-(4,4-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1-(4,4-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] propanoate?
The IUPAC name of [2-[1-(4,4-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] propanoate (CID 170316060) is [2-[1-(4,4-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] propanoate.
What is the SMILES notation for [2-[1-(4,4-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] propanoate?
The canonical SMILES for [2-[1-(4,4-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] propanoate is CCC(=O)OCC(C)(C)OC(C)C1=CCC(C)(C)C1.
What is the InChIKey of [2-[1-(4,4-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] propanoate?
The InChIKey is CJCVMEQRAQTCNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O3/c1-7-14(17)18-11-16(5,6)19-12(2)13-8-9-15(3,4)10-13/h8,12H,7,9-11H2,1-6H3.
What are the key properties of [2-[1-(4,4-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] propanoate?
[2-[1-(4,4-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] propanoate has a molecular weight of 268.40 g/mol, XLogP of 3.87, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1-(4,4-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] propanoate is sourced from PubChem (CID 170316060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).