About [2-[1-(3,3-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] 2-oxopropanoate
[2-[1-(3,3-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] 2-oxopropanoate (PubChem CID 170316068) has the molecular formula C16H26O4
and a molecular weight of 282.38 g/mol. Its IUPAC name is [2-[1-(3,3-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] 2-oxopropanoate.
Molecular Properties
| Compound Name | [2-[1-(3,3-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] 2-oxopropanoate |
| PubChem CID | 170316068 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | [2-[1-(3,3-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] 2-oxopropanoate |
| SMILES | CC(=O)C(=O)OCC(C)(C)OC(C)C1=CC(C)(C)CC1 |
| InChI | InChI=1S/C16H26O4/c1-11(17)14(18)19-10-16(5,6)20-12(2)13-7-8-15(3,4)9-13/h9,12H,7-8,10H2,1-6H3 |
| InChIKey | FBJDIDUCFFZFOV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-[1-(3,3-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1-(3,3-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] 2-oxopropanoate?
The IUPAC name of [2-[1-(3,3-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] 2-oxopropanoate (CID 170316068) is [2-[1-(3,3-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] 2-oxopropanoate.
What is the SMILES notation for [2-[1-(3,3-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] 2-oxopropanoate?
The canonical SMILES for [2-[1-(3,3-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] 2-oxopropanoate is CC(=O)C(=O)OCC(C)(C)OC(C)C1=CC(C)(C)CC1.
What is the InChIKey of [2-[1-(3,3-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] 2-oxopropanoate?
The InChIKey is FBJDIDUCFFZFOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O4/c1-11(17)14(18)19-10-16(5,6)20-12(2)13-7-8-15(3,4)9-13/h9,12H,7-8,10H2,1-6H3.
What are the key properties of [2-[1-(3,3-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] 2-oxopropanoate?
[2-[1-(3,3-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] 2-oxopropanoate has a molecular weight of 282.38 g/mol, XLogP of 3.05, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1-(3,3-dimethylcyclopenten-1-yl)ethoxy]-2-methylpropyl] 2-oxopropanoate is sourced from PubChem (CID 170316068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).