C25H25N3O2 — CID 17031709
N-(4-ethoxyphenyl)-2-[2-(2-phenylethyl)benzimidazol-1-yl]acetamide (PubChem CID 17031709) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[2-(2-phenylethyl)benzimidazol-1-yl]acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[2-(2-phenylethyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 17031709 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[2-(2-phenylethyl)benzimidazol-1-yl]acetamide |
| SMILES | CCOc1ccc(NC(=O)Cn2c(CCc3ccccc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C25H25N3O2/c1-2-30-21-15-13-20(14-16-21)26-25(29)18-28-23-11-7-6-10-22(23)27-24(28)17-12-19-8-4-3-5-9-19/h3-11,13-16H,2,12,17-18H2,1H3,(H,26,29) |
| InChIKey | XWUYCKFUHFHFHJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |