C18H21ClN8O3 — CID 170317220
N-[(2S,3R,4S,5S)-5-[2-(5-chloro-3-pyridinyl)-6-(methylamino)purin-9-yl]-1-ethyl-3,4-dihydroxypyrrolidin-2-yl]formamide (PubChem CID 170317220) has the molecular formula C18H21ClN8O3 and a molecular weight of 432.87 g/mol. Its IUPAC name is N-[(2S,3R,4S,5S)-5-[2-(5-chloro-3-pyridinyl)-6-(methylamino)purin-9-yl]-1-ethyl-3,4-dihydroxypyrrolidin-2-yl]formamide.
| Compound Name | N-[(2S,3R,4S,5S)-5-[2-(5-chloro-3-pyridinyl)-6-(methylamino)purin-9-yl]-1-ethyl-3,4-dihydroxypyrrolidin-2-yl]formamide |
|---|---|
| PubChem CID | 170317220 |
| Molecular Formula | C18H21ClN8O3 |
| Molecular Weight | 432.87 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-[(2S,3R,4S,5S)-5-[2-(5-chloro-3-pyridinyl)-6-(methylamino)purin-9-yl]-1-ethyl-3,4-dihydroxypyrrolidin-2-yl]formamide |
| SMILES | CCN1[C@H](NC=O)[C@@H](O)[C@@H](O)[C@@H]1n1cnc2c(NC)nc(-c3cncc(Cl)c3)nc21 |
| InChI | InChI=1S/C18H21ClN8O3/c1-3-26-17(23-8-28)12(29)13(30)18(26)27-7-22-11-15(20-2)24-14(25-16(11)27)9-4-10(19)6-21-5-9/h4-8,12-13,17-18,29-30H,3H2,1-2H3,(H,23,28)(H,20,24,25)/t12-,13+,17-,18-/m0/s1 |
| InChIKey | PDDVDBRCCBALCN-GGNLRSJOSA-N |
| XLogP | 0.21 |
| TPSA | 141.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.87 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|