C23H23FN8O5S — CID 170317304
(2S,3S,4R,5R)-5-[2-(5-fluoro-3-pyridinyl)-6-[(6-methyl-2-pyridinyl)methylamino]purin-9-yl]-3,4-dihydroxy-N-methyl-1,1-dioxothiolane-2-carboxamide (PubChem CID 170317304) has the molecular formula C23H23FN8O5S and a molecular weight of 542.55 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[2-(5-fluoro-3-pyridinyl)-6-[(6-methyl-2-pyridinyl)methylamino]purin-9-yl]-3,4-dihydroxy-N-methyl-1,1-dioxothiolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[2-(5-fluoro-3-pyridinyl)-6-[(6-methyl-2-pyridinyl)methylamino]purin-9-yl]-3,4-dihydroxy-N-methyl-1,1-dioxothiolane-2-carboxamide |
|---|---|
| PubChem CID | 170317304 |
| Molecular Formula | C23H23FN8O5S |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | (2S,3S,4R,5R)-5-[2-(5-fluoro-3-pyridinyl)-6-[(6-methyl-2-pyridinyl)methylamino]purin-9-yl]-3,4-dihydroxy-N-methyl-1,1-dioxothiolane-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1[C@@H](O)[C@@H](O)[C@H](n2cnc3c(NCc4cccc(C)n4)nc(-c4cncc(F)c4)nc32)S1(=O)=O |
| InChI | InChI=1S/C23H23FN8O5S/c1-11-4-3-5-14(29-11)9-27-20-15-21(31-19(30-20)12-6-13(24)8-26-7-12)32(10-28-15)23-17(34)16(33)18(22(35)25-2)38(23,36)37/h3-8,10,16-18,23,33-34H,9H2,1-2H3,(H,25,35)(H,27,30,31)/t16-,17+,18-,23+/m0/s1 |
| InChIKey | YTYKAHIDJHWGMQ-DDOIHHOZSA-N |
| XLogP | 0.11 |
| TPSA | 185.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |