C23H25F3N4O3 — CID 170317384
N-[1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-6-methoxy-2-methyl-7-(oxetan-3-ylmethoxy)quinazolin-4-amine (PubChem CID 170317384) has the molecular formula C23H25F3N4O3 and a molecular weight of 462.47 g/mol. Its IUPAC name is N-[1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-6-methoxy-2-methyl-7-(oxetan-3-ylmethoxy)quinazolin-4-amine.
| Compound Name | N-[1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-6-methoxy-2-methyl-7-(oxetan-3-ylmethoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 170317384 |
| Molecular Formula | C23H25F3N4O3 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | N-[1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-6-methoxy-2-methyl-7-(oxetan-3-ylmethoxy)quinazolin-4-amine |
| SMILES | COc1cc2c(NC(C)c3cc(N)cc(C(F)(F)F)c3)nc(C)nc2cc1OCC1COC1 |
| InChI | InChI=1S/C23H25F3N4O3/c1-12(15-4-16(23(24,25)26)6-17(27)5-15)28-22-18-7-20(31-3)21(33-11-14-9-32-10-14)8-19(18)29-13(2)30-22/h4-8,12,14H,9-11,27H2,1-3H3,(H,28,29,30) |
| InChIKey | DRIQERNCJHTTLL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|