About (1R)-2-(tert-butylamino)-1-(2,3-difluorocyclohexa-1,5-dien-1-yl)ethanol
(1R)-2-(tert-butylamino)-1-(2,3-difluorocyclohexa-1,5-dien-1-yl)ethanol (PubChem CID 170317612) has the molecular formula C12H19F2NO
and a molecular weight of 231.29 g/mol. Its IUPAC name is (1R)-2-(tert-butylamino)-1-(2,3-difluorocyclohexa-1,5-dien-1-yl)ethanol.
Molecular Properties
| Compound Name | (1R)-2-(tert-butylamino)-1-(2,3-difluorocyclohexa-1,5-dien-1-yl)ethanol |
| PubChem CID | 170317612 |
| Molecular Formula | C12H19F2NO |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | (1R)-2-(tert-butylamino)-1-(2,3-difluorocyclohexa-1,5-dien-1-yl)ethanol |
| SMILES | CC(C)(C)NC[C@H](O)C1=C(F)C(F)CC=C1 |
| InChI | InChI=1S/C12H19F2NO/c1-12(2,3)15-7-10(16)8-5-4-6-9(13)11(8)14/h4-5,9-10,15-16H,6-7H2,1-3H3/t9?,10-/m0/s1 |
| InChIKey | DQWIHFYPWHTGSG-AXDSSHIGSA-N |
| XLogP | 2.26 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-2-(tert-butylamino)-1-(2,3-difluorocyclohexa-1,5-dien-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2-(tert-butylamino)-1-(2,3-difluorocyclohexa-1,5-dien-1-yl)ethanol?
The IUPAC name of (1R)-2-(tert-butylamino)-1-(2,3-difluorocyclohexa-1,5-dien-1-yl)ethanol (CID 170317612) is (1R)-2-(tert-butylamino)-1-(2,3-difluorocyclohexa-1,5-dien-1-yl)ethanol.
What is the SMILES notation for (1R)-2-(tert-butylamino)-1-(2,3-difluorocyclohexa-1,5-dien-1-yl)ethanol?
The canonical SMILES for (1R)-2-(tert-butylamino)-1-(2,3-difluorocyclohexa-1,5-dien-1-yl)ethanol is CC(C)(C)NC[C@H](O)C1=C(F)C(F)CC=C1.
What is the InChIKey of (1R)-2-(tert-butylamino)-1-(2,3-difluorocyclohexa-1,5-dien-1-yl)ethanol?
The InChIKey is DQWIHFYPWHTGSG-AXDSSHIGSA-N. The full InChI is InChI=1S/C12H19F2NO/c1-12(2,3)15-7-10(16)8-5-4-6-9(13)11(8)14/h4-5,9-10,15-16H,6-7H2,1-3H3/t9?,10-/m0/s1.
What are the key properties of (1R)-2-(tert-butylamino)-1-(2,3-difluorocyclohexa-1,5-dien-1-yl)ethanol?
(1R)-2-(tert-butylamino)-1-(2,3-difluorocyclohexa-1,5-dien-1-yl)ethanol has a molecular weight of 231.29 g/mol, XLogP of 2.26, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2-(tert-butylamino)-1-(2,3-difluorocyclohexa-1,5-dien-1-yl)ethanol is sourced from PubChem (CID 170317612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).