About 6-iodo-N,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-amine
6-iodo-N,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-amine (PubChem CID 170318472) has the molecular formula C11H15IN2
and a molecular weight of 302.16 g/mol. Its IUPAC name is 6-iodo-N,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-amine.
Molecular Properties
| Compound Name | 6-iodo-N,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-amine |
| PubChem CID | 170318472 |
| Molecular Formula | C11H15IN2 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 6-iodo-N,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-amine |
| SMILES | CNc1cc2c(cc1I)CCN(C)C2 |
| InChI | InChI=1S/C11H15IN2/c1-13-11-6-9-7-14(2)4-3-8(9)5-10(11)12/h5-6,13H,3-4,7H2,1-2H3 |
| InChIKey | ZBOXMMJMDSDCAB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-N,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-N,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-amine?
The IUPAC name of 6-iodo-N,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-amine (CID 170318472) is 6-iodo-N,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-amine.
What is the SMILES notation for 6-iodo-N,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-amine?
The canonical SMILES for 6-iodo-N,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-amine is CNc1cc2c(cc1I)CCN(C)C2.
What is the InChIKey of 6-iodo-N,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-amine?
The InChIKey is ZBOXMMJMDSDCAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15IN2/c1-13-11-6-9-7-14(2)4-3-8(9)5-10(11)12/h5-6,13H,3-4,7H2,1-2H3.
What are the key properties of 6-iodo-N,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-amine?
6-iodo-N,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-amine has a molecular weight of 302.16 g/mol, XLogP of 2.32, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-N,2-dimethyl-3,4-dihydro-1H-isoquinolin-7-amine is sourced from PubChem (CID 170318472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).