C12H3ClF6S — CID 170318836
2-chloro-4-fluoro-5-(2,3,4,5,6-pentafluorophenyl)benzenethiol (PubChem CID 170318836) has the molecular formula C12H3ClF6S and a molecular weight of 328.66 g/mol. Its IUPAC name is 2-chloro-4-fluoro-5-(2,3,4,5,6-pentafluorophenyl)benzenethiol.
| Compound Name | 2-chloro-4-fluoro-5-(2,3,4,5,6-pentafluorophenyl)benzenethiol |
|---|---|
| PubChem CID | 170318836 |
| Molecular Formula | C12H3ClF6S |
| Molecular Weight | 328.66 g/mol |
| Exact Mass | 327.95 |
| IUPAC Name | 2-chloro-4-fluoro-5-(2,3,4,5,6-pentafluorophenyl)benzenethiol |
| SMILES | Fc1cc(Cl)c(S)cc1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H3ClF6S/c13-4-2-5(14)3(1-6(4)20)7-8(15)10(17)12(19)11(18)9(7)16/h1-2,20H |
| InChIKey | LVFZUXXVSSHOMD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.66 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|