About benzo[g]indole
benzo[g]indole (PubChem CID 170319311) has the molecular formula C12H7N
and a molecular weight of 165.19 g/mol. Its IUPAC name is benzo[g]indole.
Molecular Properties
| Compound Name | benzo[g]indole |
| PubChem CID | 170319311 |
| Molecular Formula | C12H7N |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | benzo[g]indole |
| SMILES | C1=Cc2ccc3ccccc3c2N=1 |
| InChI | InChI=1S/C12H7N/c1-2-4-11-9(3-1)5-6-10-7-8-13-12(10)11/h1-7H |
| InChIKey | VEHMQPSOLZPKRB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzo[g]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[g]indole?
The IUPAC name of benzo[g]indole (CID 170319311) is benzo[g]indole.
What is the SMILES notation for benzo[g]indole?
The canonical SMILES for benzo[g]indole is C1=Cc2ccc3ccccc3c2N=1.
What is the InChIKey of benzo[g]indole?
The InChIKey is VEHMQPSOLZPKRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N/c1-2-4-11-9(3-1)5-6-10-7-8-13-12(10)11/h1-7H.
What are the key properties of benzo[g]indole?
benzo[g]indole has a molecular weight of 165.19 g/mol, XLogP of 3.17, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[g]indole is sourced from PubChem (CID 170319311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).